C11H16ClNO — CID 84680049
2-amino-2-(5-chloro-2-propan-2-ylphenyl)ethanol (PubChem CID 84680049) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-amino-2-(5-chloro-2-propan-2-ylphenyl)ethanol.
| Compound Name | 2-amino-2-(5-chloro-2-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 84680049 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-amino-2-(5-chloro-2-propan-2-ylphenyl)ethanol |
| SMILES | CC(C)c1ccc(Cl)cc1C(N)CO |
| InChI | InChI=1S/C11H16ClNO/c1-7(2)9-4-3-8(12)5-10(9)11(13)6-14/h3-5,7,11,14H,6,13H2,1-2H3 |
| InChIKey | MCJILYMBCCNNIA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |