About 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid
3-[2-(2,2-difluoroethyl)phenyl]propanoic acid (PubChem CID 84680238) has the molecular formula C11H12F2O2
and a molecular weight of 214.21 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid |
| PubChem CID | 84680238 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1CC(F)F |
| InChI | InChI=1S/C11H12F2O2/c12-10(13)7-9-4-2-1-3-8(9)5-6-11(14)15/h1-4,10H,5-7H2,(H,14,15) |
| InChIKey | HBEXUSMGQJYGER-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid?
The IUPAC name of 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid (CID 84680238) is 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid.
What is the SMILES notation for 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid?
The canonical SMILES for 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid is O=C(O)CCc1ccccc1CC(F)F.
What is the InChIKey of 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid?
The InChIKey is HBEXUSMGQJYGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O2/c12-10(13)7-9-4-2-1-3-8(9)5-6-11(14)15/h1-4,10H,5-7H2,(H,14,15).
What are the key properties of 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid?
3-[2-(2,2-difluoroethyl)phenyl]propanoic acid has a molecular weight of 214.21 g/mol, XLogP of 2.51, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoroethyl)phenyl]propanoic acid is sourced from PubChem (CID 84680238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).