About 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol
3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol (PubChem CID 117289348) has the molecular formula C11H14F2O
and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol |
| PubChem CID | 117289348 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol |
| SMILES | OCCCc1ccccc1CC(F)F |
| InChI | InChI=1S/C11H14F2O/c12-11(13)8-10-5-2-1-4-9(10)6-3-7-14/h1-2,4-5,11,14H,3,6-8H2 |
| InChIKey | QDAYHRMRHHMPPS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol?
The IUPAC name of 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol (CID 117289348) is 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol.
What is the SMILES notation for 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol?
The canonical SMILES for 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol is OCCCc1ccccc1CC(F)F.
What is the InChIKey of 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol?
The InChIKey is QDAYHRMRHHMPPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O/c12-11(13)8-10-5-2-1-4-9(10)6-3-7-14/h1-2,4-5,11,14H,3,6-8H2.
What are the key properties of 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol?
3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol has a molecular weight of 200.23 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoroethyl)phenyl]propan-1-ol is sourced from PubChem (CID 117289348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).