C10H13F2N — CID 84660069
1-[2-(2,2-difluoroethyl)phenyl]ethanamine (PubChem CID 84660069) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethyl)phenyl]ethanamine.
| Compound Name | 1-[2-(2,2-difluoroethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 84660069 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-[2-(2,2-difluoroethyl)phenyl]ethanamine |
| SMILES | CC(N)c1ccccc1CC(F)F |
| InChI | InChI=1S/C10H13F2N/c1-7(13)9-5-3-2-4-8(9)6-10(11)12/h2-5,7,10H,6,13H2,1H3 |
| InChIKey | LKPKLUWBEIGEHC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |