C12H17F2N — CID 84723521
1-[2-(2,2-difluoroethyl)phenyl]-N-methylpropan-2-amine (PubChem CID 84723521) has the molecular formula C12H17F2N and a molecular weight of 213.27 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethyl)phenyl]-N-methylpropan-2-amine.
| Compound Name | 1-[2-(2,2-difluoroethyl)phenyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 84723521 |
| Molecular Formula | C12H17F2N |
| Molecular Weight | 213.27 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 1-[2-(2,2-difluoroethyl)phenyl]-N-methylpropan-2-amine |
| SMILES | CNC(C)Cc1ccccc1CC(F)F |
| InChI | InChI=1S/C12H17F2N/c1-9(15-2)7-10-5-3-4-6-11(10)8-12(13)14/h3-6,9,12,15H,7-8H2,1-2H3 |
| InChIKey | XWVJYRYAZPCCLF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |