C8H9NO4S — CID 84680930
4-[(methoxycarbonylamino)methyl]thiophene-2-carboxylic acid (PubChem CID 84680930) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 4-[(methoxycarbonylamino)methyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(methoxycarbonylamino)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 84680930 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 4-[(methoxycarbonylamino)methyl]thiophene-2-carboxylic acid |
| SMILES | COC(=O)NCc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C8H9NO4S/c1-13-8(12)9-3-5-2-6(7(10)11)14-4-5/h2,4H,3H2,1H3,(H,9,12)(H,10,11) |
| InChIKey | UQPNZJWSRLWCDR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |