C9H13NO3S — CID 84681130
4-tert-butyl-2-methoxy-1,3-thiazole-5-carboxylic acid (PubChem CID 84681130) has the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. Its IUPAC name is 4-tert-butyl-2-methoxy-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-tert-butyl-2-methoxy-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 84681130 |
| Molecular Formula | C9H13NO3S |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4-tert-butyl-2-methoxy-1,3-thiazole-5-carboxylic acid |
| SMILES | COc1nc(C(C)(C)C)c(C(=O)O)s1 |
| InChI | InChI=1S/C9H13NO3S/c1-9(2,3)6-5(7(11)12)14-8(10-6)13-4/h1-4H3,(H,11,12) |
| InChIKey | TUPLDRALSAMNQB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |