C12H15N3O — CID 84682811
6-methyl-3-piperazin-1-yl-2,1-benzoxazole (PubChem CID 84682811) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 6-methyl-3-piperazin-1-yl-2,1-benzoxazole.
| Compound Name | 6-methyl-3-piperazin-1-yl-2,1-benzoxazole |
|---|---|
| PubChem CID | 84682811 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 6-methyl-3-piperazin-1-yl-2,1-benzoxazole |
| SMILES | Cc1ccc2c(N3CCNCC3)onc2c1 |
| InChI | InChI=1S/C12H15N3O/c1-9-2-3-10-11(8-9)14-16-12(10)15-6-4-13-5-7-15/h2-3,8,13H,4-7H2,1H3 |
| InChIKey | PYINAAWIWKGDIK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |