About 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine
2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine (PubChem CID 84683033) has the molecular formula C10H13F2NS
and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine |
| PubChem CID | 84683033 |
| Molecular Formula | C10H13F2NS |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine |
| SMILES | NCCc1cccc(SCC(F)F)c1 |
| InChI | InChI=1S/C10H13F2NS/c11-10(12)7-14-9-3-1-2-8(6-9)4-5-13/h1-3,6,10H,4-5,7,13H2 |
| InChIKey | IUBLAZSTTXCTAH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine?
The IUPAC name of 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine (CID 84683033) is 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine.
What is the SMILES notation for 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine?
The canonical SMILES for 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine is NCCc1cccc(SCC(F)F)c1.
What is the InChIKey of 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine?
The InChIKey is IUBLAZSTTXCTAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NS/c11-10(12)7-14-9-3-1-2-8(6-9)4-5-13/h1-3,6,10H,4-5,7,13H2.
What are the key properties of 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine?
2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine has a molecular weight of 217.28 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,2-difluoroethylsulfanyl)phenyl]ethanamine is sourced from PubChem (CID 84683033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).