3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid

C9H12F2N2O2 — CID 84683427

IUPAC3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid
SMILESCC(Cc1ccnn1CC(F)F)C(=O)O
InChIInChI=1S/C9H12F2N2O2/c1-6(9(14)15)4-7-2-3-12-13(7)5-8(10)11/h2-3,6,8H,4-5H2,1H3,(H,14,15)
InChIKeyITBIQCMOYMEAGW-UHFFFAOYSA-N
MW218.20 g/mol
LogP1.41
Rot. Bonds5

About 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid

3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid (PubChem CID 84683427) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid.

Molecular Properties

Compound Name3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid
PubChem CID84683427
Molecular FormulaC9H12F2N2O2
Molecular Weight218.20 g/mol
Exact Mass218.09
IUPAC Name3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid
SMILESCC(Cc1ccnn1CC(F)F)C(=O)O
InChIInChI=1S/C9H12F2N2O2/c1-6(9(14)15)4-7-2-3-12-13(7)5-8(10)11/h2-3,6,8H,4-5H2,1H3,(H,14,15)
InChIKeyITBIQCMOYMEAGW-UHFFFAOYSA-N
XLogP1.41
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.20
LogP ≤ 51.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid?
The IUPAC name of 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid (CID 84683427) is 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid.
What is the SMILES notation for 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid?
The canonical SMILES for 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid is CC(Cc1ccnn1CC(F)F)C(=O)O.
What is the InChIKey of 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid?
The InChIKey is ITBIQCMOYMEAGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O2/c1-6(9(14)15)4-7-2-3-12-13(7)5-8(10)11/h2-3,6,8H,4-5H2,1H3,(H,14,15).
What are the key properties of 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid?
3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid has a molecular weight of 218.20 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoroethyl)pyrazol-3-yl]-2-methylpropanoic acid is sourced from PubChem (CID 84683427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).