C8H10Cl2N2O — CID 84686359
1-(3,5-dichloro-4-pyridinyl)-2-(methylamino)ethanol (PubChem CID 84686359) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-pyridinyl)-2-(methylamino)ethanol.
| Compound Name | 1-(3,5-dichloro-4-pyridinyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 84686359 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 1-(3,5-dichloro-4-pyridinyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1c(Cl)cncc1Cl |
| InChI | InChI=1S/C8H10Cl2N2O/c1-11-4-7(13)8-5(9)2-12-3-6(8)10/h2-3,7,11,13H,4H2,1H3 |
| InChIKey | CWWACIJYDULSAT-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |