C9H13ClN2O — CID 84669768
1-(3-chloro-5-methyl-4-pyridinyl)-2-(methylamino)ethanol (PubChem CID 84669768) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 1-(3-chloro-5-methyl-4-pyridinyl)-2-(methylamino)ethanol.
| Compound Name | 1-(3-chloro-5-methyl-4-pyridinyl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 84669768 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(3-chloro-5-methyl-4-pyridinyl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1c(C)cncc1Cl |
| InChI | InChI=1S/C9H13ClN2O/c1-6-3-12-4-7(10)9(6)8(13)5-11-2/h3-4,8,11,13H,5H2,1-2H3 |
| InChIKey | VNPUHFSZUCYTAA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |