C11H11NO4 — CID 84686461
5-hydroxy-2-propan-2-yl-1,3-benzoxazole-7-carboxylic acid (PubChem CID 84686461) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 5-hydroxy-2-propan-2-yl-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 5-hydroxy-2-propan-2-yl-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 84686461 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-hydroxy-2-propan-2-yl-1,3-benzoxazole-7-carboxylic acid |
| SMILES | CC(C)c1nc2cc(O)cc(C(=O)O)c2o1 |
| InChI | InChI=1S/C11H11NO4/c1-5(2)10-12-8-4-6(13)3-7(11(14)15)9(8)16-10/h3-5,13H,1-2H3,(H,14,15) |
| InChIKey | RQJWXFSHUUTIQR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |