C13H15NO3 — CID 84696633
2-tert-butyl-5-methyl-1,3-benzoxazole-7-carboxylic acid (PubChem CID 84696633) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-tert-butyl-5-methyl-1,3-benzoxazole-7-carboxylic acid.
| Compound Name | 2-tert-butyl-5-methyl-1,3-benzoxazole-7-carboxylic acid |
|---|---|
| PubChem CID | 84696633 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-tert-butyl-5-methyl-1,3-benzoxazole-7-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2oc(C(C)(C)C)nc2c1 |
| InChI | InChI=1S/C13H15NO3/c1-7-5-8(11(15)16)10-9(6-7)14-12(17-10)13(2,3)4/h5-6H,1-4H3,(H,15,16) |
| InChIKey | PKOVNKQBSRCPCH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |