C9H10Cl2FN — CID 84687329
2-(3,6-dichloro-2-fluorophenyl)-N-methylethanamine (PubChem CID 84687329) has the molecular formula C9H10Cl2FN and a molecular weight of 222.09 g/mol. Its IUPAC name is 2-(3,6-dichloro-2-fluorophenyl)-N-methylethanamine.
| Compound Name | 2-(3,6-dichloro-2-fluorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 84687329 |
| Molecular Formula | C9H10Cl2FN |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2-(3,6-dichloro-2-fluorophenyl)-N-methylethanamine |
| SMILES | CNCCc1c(Cl)ccc(Cl)c1F |
| InChI | InChI=1S/C9H10Cl2FN/c1-13-5-4-6-7(10)2-3-8(11)9(6)12/h2-3,13H,4-5H2,1H3 |
| InChIKey | FWNAPHJICLDWFD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|