About 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid
2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid (PubChem CID 84688129) has the molecular formula C11H10FNO3
and a molecular weight of 223.20 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid.
Analyze 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid?
The IUPAC name of 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid (CID 84688129) is 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid.
What is the SMILES notation for 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid?
The canonical SMILES for 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid is O=C(O)CC1=NCC(c2cccc(F)c2)O1.
What is the InChIKey of 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid?
The InChIKey is DOUSDUIQOXHWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO3/c12-8-3-1-2-7(4-8)9-6-13-10(16-9)5-11(14)15/h1-4,9H,5-6H2,(H,14,15).
What are the key properties of 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid?
2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid has a molecular weight of 223.20 g/mol, XLogP of 1.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(3-fluorophenyl)-4,5-dihydro-1,3-oxazol-2-yl]acetic acid is sourced from PubChem (CID 84688129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).