C7H7BrN4 — CID 84690918
(8-bromoimidazo[1,2-c]pyrimidin-2-yl)methanamine (PubChem CID 84690918) has the molecular formula C7H7BrN4 and a molecular weight of 227.06 g/mol. Its IUPAC name is (8-bromoimidazo[1,2-c]pyrimidin-2-yl)methanamine.
| Compound Name | (8-bromoimidazo[1,2-c]pyrimidin-2-yl)methanamine |
|---|---|
| PubChem CID | 84690918 |
| Molecular Formula | C7H7BrN4 |
| Molecular Weight | 227.06 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | (8-bromoimidazo[1,2-c]pyrimidin-2-yl)methanamine |
| SMILES | NCc1cn2cncc(Br)c2n1 |
| InChI | InChI=1S/C7H7BrN4/c8-6-2-10-4-12-3-5(1-9)11-7(6)12/h2-4H,1,9H2 |
| InChIKey | BHFFIKLFXGYGJP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.06 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |