C7H10Cl2N4 — CID 138040926
imidazo[1,2-a]pyrazin-2-ylmethanamine;dihydrochloride (PubChem CID 138040926) has the molecular formula C7H10Cl2N4 and a molecular weight of 221.09 g/mol. Its IUPAC name is imidazo[1,2-a]pyrazin-2-ylmethanamine;dihydrochloride.
| Compound Name | imidazo[1,2-a]pyrazin-2-ylmethanamine;dihydrochloride |
|---|---|
| PubChem CID | 138040926 |
| Molecular Formula | C7H10Cl2N4 |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | imidazo[1,2-a]pyrazin-2-ylmethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cn2ccncc2n1 |
| InChI | InChI=1S/C7H8N4.2ClH/c8-3-6-5-11-2-1-9-4-7(11)10-6;;/h1-2,4-5H,3,8H2;2*1H |
| InChIKey | SWPBIKTUEFBTMR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |