C6H5N3S3 — CID 123991666
2-(trisulfanyl)imidazo[1,2-a]pyrazine (PubChem CID 123991666) has the molecular formula C6H5N3S3 and a molecular weight of 215.33 g/mol. Its IUPAC name is 2-(trisulfanyl)imidazo[1,2-a]pyrazine.
| Compound Name | 2-(trisulfanyl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 123991666 |
| Molecular Formula | C6H5N3S3 |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 2-(trisulfanyl)imidazo[1,2-a]pyrazine |
| SMILES | SSSc1cn2ccncc2n1 |
| InChI | InChI=1S/C6H5N3S3/c10-12-11-6-4-9-2-1-7-3-5(9)8-6/h1-4,10H |
| InChIKey | NCRGIPHABQWZFD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|