About 2-(trisulfanyl)imidazo[1,2-a]pyrazine
2-(trisulfanyl)imidazo[1,2-a]pyrazine (PubChem CID 123991666) has the molecular formula C6H5N3S3
and a molecular weight of 215.33 g/mol. Its IUPAC name is 2-(trisulfanyl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 2-(trisulfanyl)imidazo[1,2-a]pyrazine |
| PubChem CID | 123991666 |
| Molecular Formula | C6H5N3S3 |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 2-(trisulfanyl)imidazo[1,2-a]pyrazine |
| SMILES | SSSc1cn2ccncc2n1 |
| InChI | InChI=1S/C6H5N3S3/c10-12-11-6-4-9-2-1-7-3-5(9)8-6/h1-4,10H |
| InChIKey | NCRGIPHABQWZFD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(trisulfanyl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trisulfanyl)imidazo[1,2-a]pyrazine?
The IUPAC name of 2-(trisulfanyl)imidazo[1,2-a]pyrazine (CID 123991666) is 2-(trisulfanyl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 2-(trisulfanyl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 2-(trisulfanyl)imidazo[1,2-a]pyrazine is SSSc1cn2ccncc2n1.
What is the InChIKey of 2-(trisulfanyl)imidazo[1,2-a]pyrazine?
The InChIKey is NCRGIPHABQWZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S3/c10-12-11-6-4-9-2-1-7-3-5(9)8-6/h1-4,10H.
What are the key properties of 2-(trisulfanyl)imidazo[1,2-a]pyrazine?
2-(trisulfanyl)imidazo[1,2-a]pyrazine has a molecular weight of 215.33 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trisulfanyl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 123991666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).