C16H15F3N4S — CID 168898686
(1R)-2,2,2-trifluoro-N-imidazo[1,2-a]pyrazin-2-ylsulfanyl-N-methyl-1-(4-methylphenyl)ethanamine (PubChem CID 168898686) has the molecular formula C16H15F3N4S and a molecular weight of 352.39 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-N-imidazo[1,2-a]pyrazin-2-ylsulfanyl-N-methyl-1-(4-methylphenyl)ethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-N-imidazo[1,2-a]pyrazin-2-ylsulfanyl-N-methyl-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 168898686 |
| Molecular Formula | C16H15F3N4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | (1R)-2,2,2-trifluoro-N-imidazo[1,2-a]pyrazin-2-ylsulfanyl-N-methyl-1-(4-methylphenyl)ethanamine |
| SMILES | Cc1ccc([C@@H](N(C)Sc2cn3ccncc3n2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N4S/c1-11-3-5-12(6-4-11)15(16(17,18)19)22(2)24-14-10-23-8-7-20-9-13(23)21-14/h3-10,15H,1-2H3/t15-/m1/s1 |
| InChIKey | MJIBIWGGKYQSEE-OAHLLOKOSA-N |
| XLogP | 4.28 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|