C11H9N3S — CID 104573587
2-(3-methylthiophen-2-yl)imidazo[1,2-a]pyrazine (PubChem CID 104573587) has the molecular formula C11H9N3S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-(3-methylthiophen-2-yl)imidazo[1,2-a]pyrazine.
| Compound Name | 2-(3-methylthiophen-2-yl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 104573587 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 2-(3-methylthiophen-2-yl)imidazo[1,2-a]pyrazine |
| SMILES | Cc1ccsc1-c1cn2ccncc2n1 |
| InChI | InChI=1S/C11H9N3S/c1-8-2-5-15-11(8)9-7-14-4-3-12-6-10(14)13-9/h2-7H,1H3 |
| InChIKey | ZDWIAHAKMQTHLO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |