C10H11N3O — CID 104756413
2-(oxolan-3-yl)imidazo[1,2-a]pyrazine (PubChem CID 104756413) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(oxolan-3-yl)imidazo[1,2-a]pyrazine.
| Compound Name | 2-(oxolan-3-yl)imidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 104756413 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(oxolan-3-yl)imidazo[1,2-a]pyrazine |
| SMILES | c1cn2cc(C3CCOC3)nc2cn1 |
| InChI | InChI=1S/C10H11N3O/c1-4-14-7-8(1)9-6-13-3-2-11-5-10(13)12-9/h2-3,5-6,8H,1,4,7H2 |
| InChIKey | UARGIUQQGCIBSQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |