C11H11BrN2O — CID 117131122
5-bromo-2-(oxolan-3-yl)imidazo[1,2-a]pyridine (PubChem CID 117131122) has the molecular formula C11H11BrN2O and a molecular weight of 267.13 g/mol. Its IUPAC name is 5-bromo-2-(oxolan-3-yl)imidazo[1,2-a]pyridine.
| Compound Name | 5-bromo-2-(oxolan-3-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 117131122 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 5-bromo-2-(oxolan-3-yl)imidazo[1,2-a]pyridine |
| SMILES | Brc1cccc2nc(C3CCOC3)cn12 |
| InChI | InChI=1S/C11H11BrN2O/c12-10-2-1-3-11-13-9(6-14(10)11)8-4-5-15-7-8/h1-3,6,8H,4-5,7H2 |
| InChIKey | BAFIYOLXRCSCKQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|