C10H11N3O2 — CID 117131124
2-(oxolan-3-yl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one (PubChem CID 117131124) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one.
| Compound Name | 2-(oxolan-3-yl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
|---|---|
| PubChem CID | 117131124 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(oxolan-3-yl)-3H-[1,2,4]triazolo[1,5-a]pyridin-5-one |
| SMILES | O=c1cccc2nc(C3CCOC3)[nH]n12 |
| InChI | InChI=1S/C10H11N3O2/c14-9-3-1-2-8-11-10(12-13(8)9)7-4-5-15-6-7/h1-3,7H,4-6H2,(H,11,12) |
| InChIKey | KXMGFWQLUPJUOV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |