C11H11ClN2O3S — CID 165499953
2-(oxolan-3-yl)imidazo[1,2-a]pyridine-3-sulfonyl chloride (PubChem CID 165499953) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is 2-(oxolan-3-yl)imidazo[1,2-a]pyridine-3-sulfonyl chloride.
| Compound Name | 2-(oxolan-3-yl)imidazo[1,2-a]pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 165499953 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-(oxolan-3-yl)imidazo[1,2-a]pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(C2CCOC2)nc2ccccn12 |
| InChI | InChI=1S/C11H11ClN2O3S/c12-18(15,16)11-10(8-4-6-17-7-8)13-9-3-1-2-5-14(9)11/h1-3,5,8H,4,6-7H2 |
| InChIKey | KBCFLVVQRLOVRO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |