About 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine
4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine (PubChem CID 47254192) has the molecular formula C12H14ClN3O3S
and a molecular weight of 315.78 g/mol. Its IUPAC name is 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine.
Molecular Properties
| Compound Name | 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine |
| PubChem CID | 47254192 |
| Molecular Formula | C12H14ClN3O3S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine |
| SMILES | CC1COCCN1S(=O)(=O)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C12H14ClN3O3S/c1-9-8-19-7-6-16(9)20(17,18)12-11(13)14-10-4-2-3-5-15(10)12/h2-5,9H,6-8H2,1H3 |
| InChIKey | JSMOEKRLFKQDOD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine?
The IUPAC name of 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine (CID 47254192) is 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine.
What is the SMILES notation for 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine?
The canonical SMILES for 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine is CC1COCCN1S(=O)(=O)c1c(Cl)nc2ccccn12.
What is the InChIKey of 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine?
The InChIKey is JSMOEKRLFKQDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN3O3S/c1-9-8-19-7-6-16(9)20(17,18)12-11(13)14-10-4-2-3-5-15(10)12/h2-5,9H,6-8H2,1H3.
What are the key properties of 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine?
4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine has a molecular weight of 315.78 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroimidazo[1,2-a]pyridin-3-yl)sulfonyl-3-methylmorpholine is sourced from PubChem (CID 47254192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).