C14H13N5O3 — CID 74249301
6-[5-(oxolan-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 74249301) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 6-[5-(oxolan-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[5-(oxolan-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 74249301 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 6-[5-(oxolan-3-yl)-1H-1,2,4-triazol-3-yl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(-c3n[nH]c(C4CCOC4)n3)cc2[nH]c1=O |
| InChI | InChI=1S/C14H13N5O3/c20-13-14(21)16-10-5-7(1-2-9(10)15-13)11-17-12(19-18-11)8-3-4-22-6-8/h1-2,5,8H,3-4,6H2,(H,15,20)(H,16,21)(H,17,18,19) |
| InChIKey | TVPBYQDHMJEVGW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|