C19H23N3O — CID 167623399
11-cyclohexyl-3-(oxolan-3-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 167623399) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 11-cyclohexyl-3-(oxolan-3-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 11-cyclohexyl-3-(oxolan-3-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 167623399 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 11-cyclohexyl-3-(oxolan-3-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | C1=C(C2CCOC2)c2c(ncc3nc(C4CCCCC4)cn23)C1 |
| InChI | InChI=1S/C19H23N3O/c1-2-4-13(5-3-1)17-11-22-18(21-17)10-20-16-7-6-15(19(16)22)14-8-9-23-12-14/h6,10-11,13-14H,1-5,7-9,12H2 |
| InChIKey | HLGNZXLSVHVQPI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |