C23H30BrN3O4S — CID 167588438
3-bromo-11-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2-[dimethyl(oxo)-λ6-sulfanylidene]-1-(oxan-4-yl)ethanone (PubChem CID 167588438) has the molecular formula C23H30BrN3O4S and a molecular weight of 524.48 g/mol. Its IUPAC name is 3-bromo-11-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2-[dimethyl(oxo)-λ6-sulfanylidene]-1-(oxan-4-yl)ethanone.
| Compound Name | 3-bromo-11-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2-[dimethyl(oxo)-λ6-sulfanylidene]-1-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 167588438 |
| Molecular Formula | C23H30BrN3O4S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 3-bromo-11-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene;2-[dimethyl(oxo)-λ6-sulfanylidene]-1-(oxan-4-yl)ethanone |
| SMILES | BrC1=CCc2ncc3nc(C4CCOCC4)cn3c21.CS(C)(=O)=CC(=O)C1CCOCC1 |
| InChI | InChI=1S/C14H14BrN3O.C9H16O3S/c15-10-1-2-11-14(10)18-8-12(17-13(18)7-16-11)9-3-5-19-6-4-9;1-13(2,11)7-9(10)8-3-5-12-6-4-8/h1,7-9H,2-6H2;7-8H,3-6H2,1-2H3 |
| InChIKey | ICLVXJZKCIAJMP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|