C20H26N4O — CID 167533915
11-[(2R,4R)-2-methylpiperidin-4-yl]-3-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 167533915) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 11-[(2R,4R)-2-methylpiperidin-4-yl]-3-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 11-[(2R,4R)-2-methylpiperidin-4-yl]-3-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 167533915 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 11-[(2R,4R)-2-methylpiperidin-4-yl]-3-(oxan-4-yl)-1,7,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | C[C@@H]1C[C@H](c2cn3c4c(ncc3n2)CC=C4C2CCOCC2)CCN1 |
| InChI | InChI=1S/C20H26N4O/c1-13-10-15(4-7-21-13)18-12-24-19(23-18)11-22-17-3-2-16(20(17)24)14-5-8-25-9-6-14/h2,11-15,21H,3-10H2,1H3/t13-,15-/m1/s1 |
| InChIKey | UXJHJJBMZNOOLD-UKRRQHHQSA-N |
| XLogP | 2.95 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |