C9H11ClN2O3 — CID 84694007
3-amino-2-(2-chloro-4-methoxy-3-pyridinyl)propanoic acid (PubChem CID 84694007) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is 3-amino-2-(2-chloro-4-methoxy-3-pyridinyl)propanoic acid.
| Compound Name | 3-amino-2-(2-chloro-4-methoxy-3-pyridinyl)propanoic acid |
|---|---|
| PubChem CID | 84694007 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-amino-2-(2-chloro-4-methoxy-3-pyridinyl)propanoic acid |
| SMILES | COc1ccnc(Cl)c1C(CN)C(=O)O |
| InChI | InChI=1S/C9H11ClN2O3/c1-15-6-2-3-12-8(10)7(6)5(4-11)9(13)14/h2-3,5H,4,11H2,1H3,(H,13,14) |
| InChIKey | FEDIVNDGOGPSSH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|