C14H17NO2 — CID 84694616
2-(1-benzofuran-7-yloxymethyl)piperidine (PubChem CID 84694616) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(1-benzofuran-7-yloxymethyl)piperidine.
| Compound Name | 2-(1-benzofuran-7-yloxymethyl)piperidine |
|---|---|
| PubChem CID | 84694616 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-(1-benzofuran-7-yloxymethyl)piperidine |
| SMILES | c1cc(OCC2CCCCN2)c2occc2c1 |
| InChI | InChI=1S/C14H17NO2/c1-2-8-15-12(5-1)10-17-13-6-3-4-11-7-9-16-14(11)13/h3-4,6-7,9,12,15H,1-2,5,8,10H2 |
| InChIKey | XXEYZQBIWZXMNS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |