2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid

C9H10ClNO2S — CID 84695210

IUPAC2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid
SMILESO=C(O)CC1CCc2nc(Cl)sc2C1
InChIInChI=1S/C9H10ClNO2S/c10-9-11-6-2-1-5(4-8(12)13)3-7(6)14-9/h5H,1-4H2,(H,12,13)
InChIKeyWLZNNDJJKAEDFH-UHFFFAOYSA-N
MW231.70 g/mol
LogP2.38
Rot. Bonds2

About 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid

2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid (PubChem CID 84695210) has the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. Its IUPAC name is 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid.

Molecular Properties

Compound Name2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid
PubChem CID84695210
Molecular FormulaC9H10ClNO2S
Molecular Weight231.70 g/mol
Exact Mass231.01
IUPAC Name2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid
SMILESO=C(O)CC1CCc2nc(Cl)sc2C1
InChIInChI=1S/C9H10ClNO2S/c10-9-11-6-2-1-5(4-8(12)13)3-7(6)14-9/h5H,1-4H2,(H,12,13)
InChIKeyWLZNNDJJKAEDFH-UHFFFAOYSA-N
XLogP2.38
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.70
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid?
The IUPAC name of 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid (CID 84695210) is 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid.
What is the SMILES notation for 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid?
The canonical SMILES for 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid is O=C(O)CC1CCc2nc(Cl)sc2C1.
What is the InChIKey of 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid?
The InChIKey is WLZNNDJJKAEDFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2S/c10-9-11-6-2-1-5(4-8(12)13)3-7(6)14-9/h5H,1-4H2,(H,12,13).
What are the key properties of 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid?
2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid has a molecular weight of 231.70 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl)acetic acid is sourced from PubChem (CID 84695210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).