3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid

C10H14F2N2O2 — CID 84695393

IUPAC3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid
SMILESCC(Cc1ccnn1CC(C)(F)F)C(=O)O
InChIInChI=1S/C10H14F2N2O2/c1-7(9(15)16)5-8-3-4-13-14(8)6-10(2,11)12/h3-4,7H,5-6H2,1-2H3,(H,15,16)
InChIKeyVIEMNTGTRJJLIQ-UHFFFAOYSA-N
MW232.23 g/mol
LogP1.80
Rot. Bonds5

About 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid

3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid (PubChem CID 84695393) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid.

Molecular Properties

Compound Name3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid
PubChem CID84695393
Molecular FormulaC10H14F2N2O2
Molecular Weight232.23 g/mol
Exact Mass232.10
IUPAC Name3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid
SMILESCC(Cc1ccnn1CC(C)(F)F)C(=O)O
InChIInChI=1S/C10H14F2N2O2/c1-7(9(15)16)5-8-3-4-13-14(8)6-10(2,11)12/h3-4,7H,5-6H2,1-2H3,(H,15,16)
InChIKeyVIEMNTGTRJJLIQ-UHFFFAOYSA-N
XLogP1.80
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.23
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid?
The IUPAC name of 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid (CID 84695393) is 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid.
What is the SMILES notation for 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid?
The canonical SMILES for 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid is CC(Cc1ccnn1CC(C)(F)F)C(=O)O.
What is the InChIKey of 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid?
The InChIKey is VIEMNTGTRJJLIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O2/c1-7(9(15)16)5-8-3-4-13-14(8)6-10(2,11)12/h3-4,7H,5-6H2,1-2H3,(H,15,16).
What are the key properties of 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid?
3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid has a molecular weight of 232.23 g/mol, XLogP of 1.80, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid is sourced from PubChem (CID 84695393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).