C10H14F2N2O2 — CID 84695393
3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid (PubChem CID 84695393) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid.
| Compound Name | 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 84695393 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-[2-(2,2-difluoropropyl)pyrazol-3-yl]-2-methylpropanoic acid |
| SMILES | CC(Cc1ccnn1CC(C)(F)F)C(=O)O |
| InChI | InChI=1S/C10H14F2N2O2/c1-7(9(15)16)5-8-3-4-13-14(8)6-10(2,11)12/h3-4,7H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | VIEMNTGTRJJLIQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |