C12H21F2NO — CID 84696818
2-[1-(3,3-difluorobutyl)azepan-4-yl]acetaldehyde (PubChem CID 84696818) has the molecular formula C12H21F2NO and a molecular weight of 233.30 g/mol. Its IUPAC name is 2-[1-(3,3-difluorobutyl)azepan-4-yl]acetaldehyde.
| Compound Name | 2-[1-(3,3-difluorobutyl)azepan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 84696818 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-[1-(3,3-difluorobutyl)azepan-4-yl]acetaldehyde |
| SMILES | CC(F)(F)CCN1CCCC(CC=O)CC1 |
| InChI | InChI=1S/C12H21F2NO/c1-12(13,14)6-9-15-7-2-3-11(4-8-15)5-10-16/h10-11H,2-9H2,1H3 |
| InChIKey | BCVTXINWFDWQOV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|