3-(3-chloro-2,6-difluorophenyl)butanoic acid

C10H9ClF2O2 — CID 84698122

IUPAC3-(3-chloro-2,6-difluorophenyl)butanoic acid
SMILESCC(CC(=O)O)c1c(F)ccc(Cl)c1F
InChIInChI=1S/C10H9ClF2O2/c1-5(4-8(14)15)9-7(12)3-2-6(11)10(9)13/h2-3,5H,4H2,1H3,(H,14,15)
InChIKeyFGMYNOCUFHUSBY-UHFFFAOYSA-N
MW234.63 g/mol
LogP3.20
Rot. Bonds3

About 3-(3-chloro-2,6-difluorophenyl)butanoic acid

3-(3-chloro-2,6-difluorophenyl)butanoic acid (PubChem CID 84698122) has the molecular formula C10H9ClF2O2 and a molecular weight of 234.63 g/mol. Its IUPAC name is 3-(3-chloro-2,6-difluorophenyl)butanoic acid.

Molecular Properties

Compound Name3-(3-chloro-2,6-difluorophenyl)butanoic acid
PubChem CID84698122
Molecular FormulaC10H9ClF2O2
Molecular Weight234.63 g/mol
Exact Mass234.03
IUPAC Name3-(3-chloro-2,6-difluorophenyl)butanoic acid
SMILESCC(CC(=O)O)c1c(F)ccc(Cl)c1F
InChIInChI=1S/C10H9ClF2O2/c1-5(4-8(14)15)9-7(12)3-2-6(11)10(9)13/h2-3,5H,4H2,1H3,(H,14,15)
InChIKeyFGMYNOCUFHUSBY-UHFFFAOYSA-N
XLogP3.20
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.63
LogP ≤ 53.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}

Analyze 3-(3-chloro-2,6-difluorophenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3-chloro-2,6-difluorophenyl)butanoic acid?
The IUPAC name of 3-(3-chloro-2,6-difluorophenyl)butanoic acid (CID 84698122) is 3-(3-chloro-2,6-difluorophenyl)butanoic acid.
What is the SMILES notation for 3-(3-chloro-2,6-difluorophenyl)butanoic acid?
The canonical SMILES for 3-(3-chloro-2,6-difluorophenyl)butanoic acid is CC(CC(=O)O)c1c(F)ccc(Cl)c1F.
What is the InChIKey of 3-(3-chloro-2,6-difluorophenyl)butanoic acid?
The InChIKey is FGMYNOCUFHUSBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2O2/c1-5(4-8(14)15)9-7(12)3-2-6(11)10(9)13/h2-3,5H,4H2,1H3,(H,14,15).
What are the key properties of 3-(3-chloro-2,6-difluorophenyl)butanoic acid?
3-(3-chloro-2,6-difluorophenyl)butanoic acid has a molecular weight of 234.63 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-2,6-difluorophenyl)butanoic acid is sourced from PubChem (CID 84698122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).