C6H9BrN2OS — CID 84699874
1-(4-bromo-1,2-thiazol-5-yl)-2-(methylamino)ethanol (PubChem CID 84699874) has the molecular formula C6H9BrN2OS and a molecular weight of 237.12 g/mol. Its IUPAC name is 1-(4-bromo-1,2-thiazol-5-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(4-bromo-1,2-thiazol-5-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 84699874 |
| Molecular Formula | C6H9BrN2OS |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 1-(4-bromo-1,2-thiazol-5-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1sncc1Br |
| InChI | InChI=1S/C6H9BrN2OS/c1-8-3-5(10)6-4(7)2-9-11-6/h2,5,8,10H,3H2,1H3 |
| InChIKey | RIPXKMACSFPFTP-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |