C8H13BrN2OS — CID 165446471
2-(aminomethyl)-1-(4-bromo-1,2-thiazol-5-yl)butan-1-ol (PubChem CID 165446471) has the molecular formula C8H13BrN2OS and a molecular weight of 265.18 g/mol. Its IUPAC name is 2-(aminomethyl)-1-(4-bromo-1,2-thiazol-5-yl)butan-1-ol.
| Compound Name | 2-(aminomethyl)-1-(4-bromo-1,2-thiazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 165446471 |
| Molecular Formula | C8H13BrN2OS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 2-(aminomethyl)-1-(4-bromo-1,2-thiazol-5-yl)butan-1-ol |
| SMILES | CCC(CN)C(O)c1sncc1Br |
| InChI | InChI=1S/C8H13BrN2OS/c1-2-5(3-10)7(12)8-6(9)4-11-13-8/h4-5,7,12H,2-3,10H2,1H3 |
| InChIKey | DEKRJHSGJUTXJE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |