C10H13N3O2S — CID 84701333
3-(4-amino-6-cyclopropyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid (PubChem CID 84701333) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-(4-amino-6-cyclopropyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid.
| Compound Name | 3-(4-amino-6-cyclopropyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid |
|---|---|
| PubChem CID | 84701333 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-(4-amino-6-cyclopropyl-2-sulfanylidene-1H-pyrimidin-5-yl)propanoic acid |
| SMILES | Nc1nc(=S)[nH]c(C2CC2)c1CCC(=O)O |
| InChI | InChI=1S/C10H13N3O2S/c11-9-6(3-4-7(14)15)8(5-1-2-5)12-10(16)13-9/h5H,1-4H2,(H,14,15)(H3,11,12,13,16) |
| InChIKey | HMMUQMVYOWTCOO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|