C15H16N2O — CID 84702007
3-(5-amino-5,6,7,8-tetrahydroquinolin-2-yl)phenol (PubChem CID 84702007) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-(5-amino-5,6,7,8-tetrahydroquinolin-2-yl)phenol.
| Compound Name | 3-(5-amino-5,6,7,8-tetrahydroquinolin-2-yl)phenol |
|---|---|
| PubChem CID | 84702007 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-(5-amino-5,6,7,8-tetrahydroquinolin-2-yl)phenol |
| SMILES | NC1CCCc2nc(-c3cccc(O)c3)ccc21 |
| InChI | InChI=1S/C15H16N2O/c16-13-5-2-6-15-12(13)7-8-14(17-15)10-3-1-4-11(18)9-10/h1,3-4,7-9,13,18H,2,5-6,16H2 |
| InChIKey | HUCUZPBACHMUQC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |