C11H14FNO2S — CID 84703896
2-[(3-fluorophenyl)sulfonylmethyl]pyrrolidine (PubChem CID 84703896) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)sulfonylmethyl]pyrrolidine.
| Compound Name | 2-[(3-fluorophenyl)sulfonylmethyl]pyrrolidine |
|---|---|
| PubChem CID | 84703896 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[(3-fluorophenyl)sulfonylmethyl]pyrrolidine |
| SMILES | O=S(=O)(CC1CCCN1)c1cccc(F)c1 |
| InChI | InChI=1S/C11H14FNO2S/c12-9-3-1-5-11(7-9)16(14,15)8-10-4-2-6-13-10/h1,3,5,7,10,13H,2,4,6,8H2 |
| InChIKey | QFUFSDYTNCMMKN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |