C11H13NO3S2 — CID 3091627
S-phenyl N-(1,1-dioxothiolan-3-yl)carbamothioate (PubChem CID 3091627) has the molecular formula C11H13NO3S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is S-phenyl N-(1,1-dioxothiolan-3-yl)carbamothioate.
| Compound Name | S-phenyl N-(1,1-dioxothiolan-3-yl)carbamothioate |
|---|---|
| PubChem CID | 3091627 |
| Molecular Formula | C11H13NO3S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | S-phenyl N-(1,1-dioxothiolan-3-yl)carbamothioate |
| SMILES | O=C(NC1CCS(=O)(=O)C1)Sc1ccccc1 |
| InChI | InChI=1S/C11H13NO3S2/c13-11(16-10-4-2-1-3-5-10)12-9-6-7-17(14,15)8-9/h1-5,9H,6-8H2,(H,12,13) |
| InChIKey | HAFRXQWZNCABQJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|