C9H14F6N2 — CID 84711201
1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperazine (PubChem CID 84711201) has the molecular formula C9H14F6N2 and a molecular weight of 264.21 g/mol. Its IUPAC name is 1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperazine.
| Compound Name | 1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperazine |
|---|---|
| PubChem CID | 84711201 |
| Molecular Formula | C9H14F6N2 |
| Molecular Weight | 264.21 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 1-[4,4,4-trifluoro-3-(trifluoromethyl)butyl]piperazine |
| SMILES | FC(F)(F)C(CCN1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F6N2/c10-8(11,12)7(9(13,14)15)1-4-17-5-2-16-3-6-17/h7,16H,1-6H2 |
| InChIKey | FUBWREDHOWSIJZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |