About spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride
spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride (PubChem CID 84713957) has the molecular formula C11H11ClO4S
and a molecular weight of 274.72 g/mol. Its IUPAC name is spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride.
Molecular Properties
| Compound Name | spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride |
| PubChem CID | 84713957 |
| Molecular Formula | C11H11ClO4S |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride |
| SMILES | O=S(=O)(Cl)Cc1ccc2c(c1)OC1(CCC1)O2 |
| InChI | InChI=1S/C11H11ClO4S/c12-17(13,14)7-8-2-3-9-10(6-8)16-11(15-9)4-1-5-11/h2-3,6H,1,4-5,7H2 |
| InChIKey | BUYWLOADEQBULZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride?
The IUPAC name of spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride (CID 84713957) is spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride.
What is the SMILES notation for spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride?
The canonical SMILES for spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride is O=S(=O)(Cl)Cc1ccc2c(c1)OC1(CCC1)O2.
What is the InChIKey of spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride?
The InChIKey is BUYWLOADEQBULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClO4S/c12-17(13,14)7-8-2-3-9-10(6-8)16-11(15-9)4-1-5-11/h2-3,6H,1,4-5,7H2.
What are the key properties of spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride?
spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride has a molecular weight of 274.72 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylmethanesulfonyl chloride is sourced from PubChem (CID 84713957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).