C14H18BrN — CID 84715073
1-(2-bromophenyl)-2-cyclopentylcyclopropan-1-amine (PubChem CID 84715073) has the molecular formula C14H18BrN and a molecular weight of 280.21 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-cyclopentylcyclopropan-1-amine.
| Compound Name | 1-(2-bromophenyl)-2-cyclopentylcyclopropan-1-amine |
|---|---|
| PubChem CID | 84715073 |
| Molecular Formula | C14H18BrN |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 1-(2-bromophenyl)-2-cyclopentylcyclopropan-1-amine |
| SMILES | NC1(c2ccccc2Br)CC1C1CCCC1 |
| InChI | InChI=1S/C14H18BrN/c15-13-8-4-3-7-11(13)14(16)9-12(14)10-5-1-2-6-10/h3-4,7-8,10,12H,1-2,5-6,9,16H2 |
| InChIKey | YDCHILJFSYNYFI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |