C10H6BrNO2S — CID 84715258
2-bromo-5-(3-hydroxyphenyl)-1,3-thiazole-4-carbaldehyde (PubChem CID 84715258) has the molecular formula C10H6BrNO2S and a molecular weight of 284.13 g/mol. Its IUPAC name is 2-bromo-5-(3-hydroxyphenyl)-1,3-thiazole-4-carbaldehyde.
| Compound Name | 2-bromo-5-(3-hydroxyphenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| PubChem CID | 84715258 |
| Molecular Formula | C10H6BrNO2S |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 282.93 |
| IUPAC Name | 2-bromo-5-(3-hydroxyphenyl)-1,3-thiazole-4-carbaldehyde |
| SMILES | O=Cc1nc(Br)sc1-c1cccc(O)c1 |
| InChI | InChI=1S/C10H6BrNO2S/c11-10-12-8(5-13)9(15-10)6-2-1-3-7(14)4-6/h1-5,14H |
| InChIKey | MQABUATVRGLIRF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|