About 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile
2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile (PubChem CID 84716793) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile.
Analyze 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile (CID 84716793) is 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile is Cn1cc2c(n1)CCCC2C#N.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile?
The InChIKey is IQFHCSZZVDTOCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-12-6-8-7(5-10)3-2-4-9(8)11-12/h6-7H,2-4H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile?
2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile has a molecular weight of 161.21 g/mol, XLogP of 1.36, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydroindazole-4-carbonitrile is sourced from PubChem (CID 84716793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).