About 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine
2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine (PubChem CID 84718578) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine.
Analyze 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine?
The IUPAC name of 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine (CID 84718578) is 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine.
What is the SMILES notation for 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine?
The canonical SMILES for 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine is Cc1ncc2scc(CCN)n12.
What is the InChIKey of 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine?
The InChIKey is HHAORUNCOCZHMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-6-10-4-8-11(6)7(2-3-9)5-12-8/h4-5H,2-3,9H2,1H3.
What are the key properties of 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine?
2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine has a molecular weight of 181.26 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylimidazo[5,1-b][1,3]thiazol-3-yl)ethanamine is sourced from PubChem (CID 84718578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).