C12H13F3 — CID 84723631
1-[1-(1,1-difluoroethyl)cyclobutyl]-3-fluorobenzene (PubChem CID 84723631) has the molecular formula C12H13F3 and a molecular weight of 214.23 g/mol. Its IUPAC name is 1-[1-(1,1-difluoroethyl)cyclobutyl]-3-fluorobenzene.
| Compound Name | 1-[1-(1,1-difluoroethyl)cyclobutyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 84723631 |
| Molecular Formula | C12H13F3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-[1-(1,1-difluoroethyl)cyclobutyl]-3-fluorobenzene |
| SMILES | CC(F)(F)C1(c2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C12H13F3/c1-11(14,15)12(6-3-7-12)9-4-2-5-10(13)8-9/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | UOJACUVIVDECBQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |