C11H9ClO3 — CID 84725566
5-chloro-4-methyl-2H-chromene-3-carboxylic acid (PubChem CID 84725566) has the molecular formula C11H9ClO3 and a molecular weight of 224.64 g/mol. Its IUPAC name is 5-chloro-4-methyl-2H-chromene-3-carboxylic acid.
| Compound Name | 5-chloro-4-methyl-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 84725566 |
| Molecular Formula | C11H9ClO3 |
| Molecular Weight | 224.64 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 5-chloro-4-methyl-2H-chromene-3-carboxylic acid |
| SMILES | CC1=C(C(=O)O)COc2cccc(Cl)c21 |
| InChI | InChI=1S/C11H9ClO3/c1-6-7(11(13)14)5-15-9-4-2-3-8(12)10(6)9/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | KEGYPUWYKKXTKX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |